C15H20ClN3O2S — CID 120745296
(4R)-4-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride (PubChem CID 120745296) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is (4R)-4-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120745296 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (4R)-4-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride |
| SMILES | Cl.NC[C@@H]1CN(C(=O)[C@@H]2CSC(=O)N2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H19N3O2S.ClH/c16-6-11-7-18(14(19)13-9-21-15(20)17-13)8-12(11)10-4-2-1-3-5-10;/h1-5,11-13H,6-9,16H2,(H,17,20);1H/t11-,12+,13+;/m1./s1 |
| InChIKey | HVUOYYRFTRLQBF-UQGASIHSSA-N |
| XLogP | 1.43 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|