C17H22N4O3 — CID 120746137
1-[2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 120746137) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120746137 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)NC(=O)N1CC(=O)N1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H22N4O3/c1-17(2)15(23)19-16(24)21(17)10-14(22)20-8-12(13(18)9-20)11-6-4-3-5-7-11/h3-7,12-13H,8-10,18H2,1-2H3,(H,19,23,24)/t12-,13+/m0/s1 |
| InChIKey | JDUPDPUKUOLHKL-QWHCGFSZSA-N |
| XLogP | 0.27 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|