C17H24N2O3S — CID 120746375
1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-cyclopentylsulfonylethanone (PubChem CID 120746375) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-cyclopentylsulfonylethanone.
| Compound Name | 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-cyclopentylsulfonylethanone |
|---|---|
| PubChem CID | 120746375 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-2-cyclopentylsulfonylethanone |
| SMILES | N[C@@H]1CN(C(=O)CS(=O)(=O)C2CCCC2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H24N2O3S/c18-16-11-19(10-15(16)13-6-2-1-3-7-13)17(20)12-23(21,22)14-8-4-5-9-14/h1-3,6-7,14-16H,4-5,8-12,18H2/t15-,16+/m0/s1 |
| InChIKey | XWXHDOBUMUBVLM-JKSUJKDBSA-N |
| XLogP | 1.30 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |