C18H19N3O4 — CID 120748052
[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone (PubChem CID 120748052) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone.
| Compound Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 120748052 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O4/c1-25-17-9-13(7-8-16(17)21(23)24)18(22)20-10-14(15(19)11-20)12-5-3-2-4-6-12/h2-9,14-15H,10-11,19H2,1H3/t14-,15+/m0/s1 |
| InChIKey | OYXFNXAJNLKGDW-LSDHHAIUSA-N |
| XLogP | 2.17 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|