C16H22N4O3 — CID 120751433
[3-[(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 120751433) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is [3-[(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-[(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 120751433 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [3-[(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | COc1cc2c(cc1OC)CCN(Cc1noc(CN)n1)CC2 |
| InChI | InChI=1S/C16H22N4O3/c1-21-13-7-11-3-5-20(6-4-12(11)8-14(13)22-2)10-15-18-16(9-17)23-19-15/h7-8H,3-6,9-10,17H2,1-2H3 |
| InChIKey | OFFBUENRJQPNEH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |