C19H33N5O2 — CID 120751621
1-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-butan-2-yl-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide (PubChem CID 120751621) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-butan-2-yl-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide.
| Compound Name | 1-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-butan-2-yl-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 120751621 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 1-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-butan-2-yl-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1CC(C)N(Cc2noc(CN)n2)C2CCCCC12 |
| InChI | InChI=1S/C19H33N5O2/c1-4-12(2)21-19(25)15-9-13(3)24(16-8-6-5-7-14(15)16)11-17-22-18(10-20)26-23-17/h12-16H,4-11,20H2,1-3H3,(H,21,25) |
| InChIKey | KCIJCSFZCWTIBW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |