About N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine
N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine (PubChem CID 120752454) has the molecular formula C11H22N4O
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine.
Molecular Properties
| Compound Name | N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine |
| PubChem CID | 120752454 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine |
| SMILES | CCC(CC)(CC)NCc1noc(CN)n1 |
| InChI | InChI=1S/C11H22N4O/c1-4-11(5-2,6-3)13-8-9-14-10(7-12)16-15-9/h13H,4-8,12H2,1-3H3 |
| InChIKey | LTCCJJXGKMNOGK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine?
The IUPAC name of N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine (CID 120752454) is N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine.
What is the SMILES notation for N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine?
The canonical SMILES for N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine is CCC(CC)(CC)NCc1noc(CN)n1.
What is the InChIKey of N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine?
The InChIKey is LTCCJJXGKMNOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O/c1-4-11(5-2,6-3)13-8-9-14-10(7-12)16-15-9/h13H,4-8,12H2,1-3H3.
What are the key properties of N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine?
N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine has a molecular weight of 226.32 g/mol, XLogP of 1.59, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-3-ethylpentan-3-amine is sourced from PubChem (CID 120752454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).