About [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride
[3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride (PubChem CID 120752666) has the molecular formula C14H21Cl2N5O2
and a molecular weight of 362.26 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride |
| PubChem CID | 120752666 |
| Molecular Formula | C14H21Cl2N5O2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1nc(CN2CCC(Oc3ccccn3)CC2)no1 |
| InChI | InChI=1S/C14H19N5O2.2ClH/c15-9-14-17-12(18-21-14)10-19-7-4-11(5-8-19)20-13-3-1-2-6-16-13;;/h1-3,6,11H,4-5,7-10,15H2;2*1H |
| InChIKey | LWRBOWTVJDRIJQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
The IUPAC name of [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride (CID 120752666) is [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride.
What is the SMILES notation for [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
The canonical SMILES for [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride is Cl.Cl.NCc1nc(CN2CCC(Oc3ccccn3)CC2)no1.
What is the InChIKey of [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
The InChIKey is LWRBOWTVJDRIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2.2ClH/c15-9-14-17-12(18-21-14)10-19-7-4-11(5-8-19)20-13-3-1-2-6-16-13;;/h1-3,6,11H,4-5,7-10,15H2;2*1H.
What are the key properties of [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
[3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride has a molecular weight of 362.26 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-pyridin-2-yloxypiperidin-1-yl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride is sourced from PubChem (CID 120752666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).