C20H22F3N3O2 — CID 120753156
2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 120753156) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 120753156 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccccc1C1CNCCN1CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O2/c1-28-18-9-5-2-6-14(18)17-12-24-10-11-26(17)13-19(27)25-16-8-4-3-7-15(16)20(21,22)23/h2-9,17,24H,10-13H2,1H3,(H,25,27) |
| InChIKey | FQRCFINVEUSNOS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |