C21H28ClN3O3 — CID 120754009
N-(4-ethoxyphenyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride (PubChem CID 120754009) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(4-ethoxyphenyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120754009 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)CN2CCNCC2c2ccccc2OC)cc1.Cl |
| InChI | InChI=1S/C21H27N3O3.ClH/c1-3-27-17-10-8-16(9-11-17)23-21(25)15-24-13-12-22-14-19(24)18-6-4-5-7-20(18)26-2;/h4-11,19,22H,3,12-15H2,1-2H3,(H,23,25);1H |
| InChIKey | DBOXERNFYSZCIA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |