About 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole
1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole (PubChem CID 1207569) has the molecular formula C22H22N2
and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole |
| PubChem CID | 1207569 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1cccc2c(-n3c(C)ccc3C)cccc12 |
| InChI | InChI=1S/C22H22N2/c1-15-11-12-16(2)23(15)21-9-5-8-20-19(21)7-6-10-22(20)24-17(3)13-14-18(24)4/h5-14H,1-4H3 |
| InChIKey | OTQAHZUKBIGBMU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole?
The IUPAC name of 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole (CID 1207569) is 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole.
What is the SMILES notation for 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole?
The canonical SMILES for 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole is Cc1ccc(C)n1-c1cccc2c(-n3c(C)ccc3C)cccc12.
What is the InChIKey of 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole?
The InChIKey is OTQAHZUKBIGBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2/c1-15-11-12-16(2)23(15)21-9-5-8-20-19(21)7-6-10-22(20)24-17(3)13-14-18(24)4/h5-14H,1-4H3.
What are the key properties of 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole?
1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole has a molecular weight of 314.43 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,5-dimethylpyrrol-1-yl)naphthalen-1-yl]-2,5-dimethylpyrrole is sourced from PubChem (CID 1207569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).