C21H27ClN4O4 — CID 120758174
2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide;hydrochloride (PubChem CID 120758174) has the molecular formula C21H27ClN4O4 and a molecular weight of 434.92 g/mol. Its IUPAC name is 2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120758174 |
| Molecular Formula | C21H27ClN4O4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2CC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C21H26N4O4.ClH/c1-3-15-4-6-16(7-5-15)20-13-22-10-11-24(20)14-21(26)23-18-9-8-17(29-2)12-19(18)25(27)28;/h4-9,12,20,22H,3,10-11,13-14H2,1-2H3,(H,23,26);1H |
| InChIKey | UVLLJTCIUHAVBF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|