C18H22ClIN2 — CID 120759007
[(3R,4R)-1-[(4-iodophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120759007) has the molecular formula C18H22ClIN2 and a molecular weight of 428.75 g/mol. Its IUPAC name is [(3R,4R)-1-[(4-iodophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [(3R,4R)-1-[(4-iodophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120759007 |
| Molecular Formula | C18H22ClIN2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | [(3R,4R)-1-[(4-iodophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@@H]1CN(Cc2ccc(I)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H21IN2.ClH/c19-17-8-6-14(7-9-17)11-21-12-16(10-20)18(13-21)15-4-2-1-3-5-15;/h1-9,16,18H,10-13,20H2;1H/t16-,18+;/m1./s1 |
| InChIKey | MDYOIWSDRXRWMG-CLRXKPRGSA-N |
| XLogP | 3.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|