C23H33N3O — CID 120760033
N-(1-adamantyl)-2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]acetamide (PubChem CID 120760033) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 120760033 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | N-(1-adamantyl)-2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]acetamide |
| SMILES | NC[C@@H]1CN(CC(=O)NC23CC4CC(CC(C4)C2)C3)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H33N3O/c24-12-20-13-26(14-21(20)19-4-2-1-3-5-19)15-22(27)25-23-9-16-6-17(10-23)8-18(7-16)11-23/h1-5,16-18,20-21H,6-15,24H2,(H,25,27)/t16?,17?,18?,20-,21+,23?/m1/s1 |
| InChIKey | ASYVOYIGWQZCPW-CLFQVDMQSA-N |
| XLogP | 2.75 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |