C18H19Cl2N3O — CID 120761039
2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 120761039) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 120761039 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | N[C@@H]1CN(CC(=O)Nc2cccc(Cl)c2Cl)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-14-7-4-8-16(18(14)20)22-17(24)11-23-9-13(15(21)10-23)12-5-2-1-3-6-12/h1-8,13,15H,9-11,21H2,(H,22,24)/t13-,15+/m0/s1 |
| InChIKey | JRFMZFZDSNXSQD-DZGCQCFKSA-N |
| XLogP | 3.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |