C20H27FN6 — CID 120768428
5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]-2-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 120768428) has the molecular formula C20H27FN6 and a molecular weight of 370.48 g/mol. Its IUPAC name is 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]-2-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]-2-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 120768428 |
| Molecular Formula | C20H27FN6 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]-2-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | CN1CCN(c2ncc(CN3CCNCC3c3cccc(F)c3)cn2)CC1 |
| InChI | InChI=1S/C20H27FN6/c1-25-7-9-26(10-8-25)20-23-12-16(13-24-20)15-27-6-5-22-14-19(27)17-3-2-4-18(21)11-17/h2-4,11-13,19,22H,5-10,14-15H2,1H3 |
| InChIKey | KZWLFDWLJUKHOA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |