C13H16N4S — CID 120769866
(3S,4R)-4-phenyl-1-(thiadiazol-4-ylmethyl)pyrrolidin-3-amine (PubChem CID 120769866) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-(thiadiazol-4-ylmethyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-phenyl-1-(thiadiazol-4-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 120769866 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (3S,4R)-4-phenyl-1-(thiadiazol-4-ylmethyl)pyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(Cc2csnn2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H16N4S/c14-13-8-17(6-11-9-18-16-15-11)7-12(13)10-4-2-1-3-5-10/h1-5,9,12-13H,6-8,14H2/t12-,13+/m0/s1 |
| InChIKey | DRFBXTLODVWCLZ-QWHCGFSZSA-N |
| XLogP | 1.46 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |