About (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride
(3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride (PubChem CID 120770237) has the molecular formula C16H22ClN3S
and a molecular weight of 323.89 g/mol. Its IUPAC name is (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride |
| PubChem CID | 120770237 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride |
| SMILES | CCc1cnc(CN2C[C@@H](N)[C@H](c3ccccc3)C2)s1.Cl |
| InChI | InChI=1S/C16H21N3S.ClH/c1-2-13-8-18-16(20-13)11-19-9-14(15(17)10-19)12-6-4-3-5-7-12;/h3-8,14-15H,2,9-11,17H2,1H3;1H/t14-,15+;/m0./s1 |
| InChIKey | RUYQZNQRQSYKPB-LDXVYITESA-N |
| XLogP | 3.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride?
The IUPAC name of (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride (CID 120770237) is (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride.
What is the SMILES notation for (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride?
The canonical SMILES for (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride is CCc1cnc(CN2C[C@@H](N)[C@H](c3ccccc3)C2)s1.Cl.
What is the InChIKey of (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride?
The InChIKey is RUYQZNQRQSYKPB-LDXVYITESA-N. The full InChI is InChI=1S/C16H21N3S.ClH/c1-2-13-8-18-16(20-13)11-19-9-14(15(17)10-19)12-6-4-3-5-7-12;/h3-8,14-15H,2,9-11,17H2,1H3;1H/t14-,15+;/m0./s1.
What are the key properties of (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride?
(3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride has a molecular weight of 323.89 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4-phenylpyrrolidin-3-amine;hydrochloride is sourced from PubChem (CID 120770237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).