About Diphenylphosphorylthioformic acid morpholide
Diphenylphosphorylthioformic acid morpholide (PubChem CID 12077037) has the molecular formula C17H18NO2PS
and a molecular weight of 331.40 g/mol. Its IUPAC name is diphenylphosphoryl(morpholin-4-yl)methanethione.
Molecular Properties
| Compound Name | Diphenylphosphorylthioformic acid morpholide |
| PubChem CID | 12077037 |
| Molecular Formula | C17H18NO2PS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | diphenylphosphoryl(morpholin-4-yl)methanethione |
| SMILES | C1COCCN1C(=S)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | InChI=1S/C17H18NO2PS/c19-21(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17(22)18-11-13-20-14-12-18/h1-10H,11-14H2 |
| InChIKey | CHWQQBTUPRYXAW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 402 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze Diphenylphosphorylthioformic acid morpholide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenylphosphorylthioformic acid morpholide?
The IUPAC name of Diphenylphosphorylthioformic acid morpholide (CID 12077037) is diphenylphosphoryl(morpholin-4-yl)methanethione.
What is the SMILES notation for Diphenylphosphorylthioformic acid morpholide?
The canonical SMILES for Diphenylphosphorylthioformic acid morpholide is C1COCCN1C(=S)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3.
What is the InChIKey of Diphenylphosphorylthioformic acid morpholide?
The InChIKey is CHWQQBTUPRYXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18NO2PS/c19-21(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17(22)18-11-13-20-14-12-18/h1-10H,11-14H2.
What are the key properties of Diphenylphosphorylthioformic acid morpholide?
Diphenylphosphorylthioformic acid morpholide has a molecular weight of 331.40 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenylphosphorylthioformic acid morpholide is sourced from PubChem (CID 12077037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).