C13H21I2N3O — CID 120770579
1-tert-butyl-2-[2-(4-iodophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 120770579) has the molecular formula C13H21I2N3O and a molecular weight of 489.14 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(4-iodophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[2-(4-iodophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120770579 |
| Molecular Formula | C13H21I2N3O |
| Molecular Weight | 489.14 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 1-tert-butyl-2-[2-(4-iodophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CC(C)(C)N/C(N)=N/CCOc1ccc(I)cc1.I |
| InChI | InChI=1S/C13H20IN3O.HI/c1-13(2,3)17-12(15)16-8-9-18-11-6-4-10(14)5-7-11;/h4-7H,8-9H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | SZUPVVNWKSYWCX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|