C15H22N4O3 — CID 120772304
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide (PubChem CID 120772304) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 120772304 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)CN1CCC(C)(CN)C1 |
| InChI | InChI=1S/C15H22N4O3/c1-11-4-3-5-12(19(21)22)14(11)17-13(20)8-18-7-6-15(2,9-16)10-18/h3-5H,6-10,16H2,1-2H3,(H,17,20) |
| InChIKey | IKEFGWDZGAOUTI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|