C16H32ClN3O — CID 120772426
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-cyclohexylethyl)acetamide;hydrochloride (PubChem CID 120772426) has the molecular formula C16H32ClN3O and a molecular weight of 317.91 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-cyclohexylethyl)acetamide;hydrochloride.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-cyclohexylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120772426 |
| Molecular Formula | C16H32ClN3O |
| Molecular Weight | 317.91 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(2-cyclohexylethyl)acetamide;hydrochloride |
| SMILES | CC1(CN)CCN(CC(=O)NCCC2CCCCC2)C1.Cl |
| InChI | InChI=1S/C16H31N3O.ClH/c1-16(12-17)8-10-19(13-16)11-15(20)18-9-7-14-5-3-2-4-6-14;/h14H,2-13,17H2,1H3,(H,18,20);1H |
| InChIKey | RWAHFGTZAIUGDI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.91 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |