About 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride
3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride (PubChem CID 120775440) has the molecular formula C15H30ClN3O
and a molecular weight of 303.88 g/mol. Its IUPAC name is 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride |
| PubChem CID | 120775440 |
| Molecular Formula | C15H30ClN3O |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride |
| SMILES | CC(C)N1CCCC(N2CCC(N)C(C)(C)C2)C1=O.Cl |
| InChI | InChI=1S/C15H29N3O.ClH/c1-11(2)18-8-5-6-12(14(18)19)17-9-7-13(16)15(3,4)10-17;/h11-13H,5-10,16H2,1-4H3;1H |
| InChIKey | KMQPQKMZLJCHSH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride?
The IUPAC name of 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride (CID 120775440) is 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride.
What is the SMILES notation for 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride?
The canonical SMILES for 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride is CC(C)N1CCCC(N2CCC(N)C(C)(C)C2)C1=O.Cl.
What is the InChIKey of 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride?
The InChIKey is KMQPQKMZLJCHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O.ClH/c1-11(2)18-8-5-6-12(14(18)19)17-9-7-13(16)15(3,4)10-17;/h11-13H,5-10,16H2,1-4H3;1H.
What are the key properties of 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride?
3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride has a molecular weight of 303.88 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-3,3-dimethylpiperidin-1-yl)-1-propan-2-ylpiperidin-2-one;hydrochloride is sourced from PubChem (CID 120775440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).