C22H29N3O — CID 120776587
N-[3-[1-(4-amino-3,3-dimethylpiperidin-1-yl)ethyl]phenyl]benzamide (PubChem CID 120776587) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[3-[1-(4-amino-3,3-dimethylpiperidin-1-yl)ethyl]phenyl]benzamide.
| Compound Name | N-[3-[1-(4-amino-3,3-dimethylpiperidin-1-yl)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 120776587 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[3-[1-(4-amino-3,3-dimethylpiperidin-1-yl)ethyl]phenyl]benzamide |
| SMILES | CC(c1cccc(NC(=O)c2ccccc2)c1)N1CCC(N)C(C)(C)C1 |
| InChI | InChI=1S/C22H29N3O/c1-16(25-13-12-20(23)22(2,3)15-25)18-10-7-11-19(14-18)24-21(26)17-8-5-4-6-9-17/h4-11,14,16,20H,12-13,15,23H2,1-3H3,(H,24,26) |
| InChIKey | OMWHWWZMOLBJGZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |