About [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride
[1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120777197) has the molecular formula C14H22BrClN2O4S
and a molecular weight of 429.76 g/mol. Its IUPAC name is [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| PubChem CID | 120777197 |
| Molecular Formula | C14H22BrClN2O4S |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | COc1cc(S(=O)(=O)N2CCC(C)(CN)C2)c(OC)cc1Br.Cl |
| InChI | InChI=1S/C14H21BrN2O4S.ClH/c1-14(8-16)4-5-17(9-14)22(18,19)13-7-11(20-2)10(15)6-12(13)21-3;/h6-7H,4-5,8-9,16H2,1-3H3;1H |
| InChIKey | SZWYKLLGVLZACT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride?
The IUPAC name of [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (CID 120777197) is [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
What is the SMILES notation for [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride?
The canonical SMILES for [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride is COc1cc(S(=O)(=O)N2CCC(C)(CN)C2)c(OC)cc1Br.Cl.
What is the InChIKey of [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride?
The InChIKey is SZWYKLLGVLZACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrN2O4S.ClH/c1-14(8-16)4-5-17(9-14)22(18,19)13-7-11(20-2)10(15)6-12(13)21-3;/h6-7H,4-5,8-9,16H2,1-3H3;1H.
What are the key properties of [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride?
[1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride has a molecular weight of 429.76 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromo-2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride is sourced from PubChem (CID 120777197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).