C14H23N3O4S — CID 120777512
ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate (PubChem CID 120777512) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 120777512 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)N2CCC(C)(CN)C2)cn1C |
| InChI | InChI=1S/C14H23N3O4S/c1-4-21-13(18)12-7-11(8-16(12)3)22(19,20)17-6-5-14(2,9-15)10-17/h7-8H,4-6,9-10,15H2,1-3H3 |
| InChIKey | WWLJJJQCHAJYAA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |