C13H18ClFN2O2S — CID 120777896
[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 120777896) has the molecular formula C13H18ClFN2O2S and a molecular weight of 320.82 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120777896 |
| Molecular Formula | C13H18ClFN2O2S |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [1-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(C)(CN)C2)c(Cl)cc1F |
| InChI | InChI=1S/C13H18ClFN2O2S/c1-9-5-12(10(14)6-11(9)15)20(18,19)17-4-3-13(2,7-16)8-17/h5-6H,3-4,7-8,16H2,1-2H3 |
| InChIKey | LGYSJHAEZSUPRE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |