About [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine
[3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 120778096) has the molecular formula C11H17F3N4O2S
and a molecular weight of 326.34 g/mol. Its IUPAC name is [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine |
| PubChem CID | 120778096 |
| Molecular Formula | C11H17F3N4O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2cnn(CC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C11H17F3N4O2S/c1-10(6-15)2-3-18(7-10)21(19,20)9-4-16-17(5-9)8-11(12,13)14/h4-5H,2-3,6-8,15H2,1H3 |
| InChIKey | HCYRGRDAHKLPLI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine?
The IUPAC name of [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine (CID 120778096) is [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine is CC1(CN)CCN(S(=O)(=O)c2cnn(CC(F)(F)F)c2)C1.
What is the InChIKey of [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine?
The InChIKey is HCYRGRDAHKLPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N4O2S/c1-10(6-15)2-3-18(7-10)21(19,20)9-4-16-17(5-9)8-11(12,13)14/h4-5H,2-3,6-8,15H2,1H3.
What are the key properties of [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine?
[3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine has a molecular weight of 326.34 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 120778096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).