About [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine
[1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 120778098) has the molecular formula C11H18F2N4O2S
and a molecular weight of 308.35 g/mol. Its IUPAC name is [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 120778098 |
| Molecular Formula | C11H18F2N4O2S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2cnn(CC(F)F)c2)C1 |
| InChI | InChI=1S/C11H18F2N4O2S/c1-11(7-14)2-3-17(8-11)20(18,19)9-4-15-16(5-9)6-10(12)13/h4-5,10H,2-3,6-8,14H2,1H3 |
| InChIKey | DLYPPSPHZDKXTR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine (CID 120778098) is [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine is CC1(CN)CCN(S(=O)(=O)c2cnn(CC(F)F)c2)C1.
What is the InChIKey of [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine?
The InChIKey is DLYPPSPHZDKXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N4O2S/c1-11(7-14)2-3-17(8-11)20(18,19)9-4-15-16(5-9)6-10(12)13/h4-5,10H,2-3,6-8,14H2,1H3.
What are the key properties of [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine?
[1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine has a molecular weight of 308.35 g/mol, XLogP of 0.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-(2,2-difluoroethyl)pyrazol-4-yl]sulfonyl-3-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 120778098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).