About 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride
2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride (PubChem CID 120778361) has the molecular formula C11H23ClF3N3O3S
and a molecular weight of 369.84 g/mol. Its IUPAC name is 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride |
| PubChem CID | 120778361 |
| Molecular Formula | C11H23ClF3N3O3S |
| Molecular Weight | 369.84 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride |
| SMILES | CCOCCS(=O)(=O)NCC(N1CCNCC1)C(F)(F)F.Cl |
| InChI | InChI=1S/C11H22F3N3O3S.ClH/c1-2-20-7-8-21(18,19)16-9-10(11(12,13)14)17-5-3-15-4-6-17;/h10,15-16H,2-9H2,1H3;1H |
| InChIKey | PTQKGLVDWOVJRJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.84 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride?
The IUPAC name of 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride (CID 120778361) is 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride.
What is the SMILES notation for 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride?
The canonical SMILES for 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride is CCOCCS(=O)(=O)NCC(N1CCNCC1)C(F)(F)F.Cl.
What is the InChIKey of 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride?
The InChIKey is PTQKGLVDWOVJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3N3O3S.ClH/c1-2-20-7-8-21(18,19)16-9-10(11(12,13)14)17-5-3-15-4-6-17;/h10,15-16H,2-9H2,1H3;1H.
What are the key properties of 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride?
2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride has a molecular weight of 369.84 g/mol, XLogP of 0.20, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)ethanesulfonamide;hydrochloride is sourced from PubChem (CID 120778361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).