About 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide
3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide (PubChem CID 120778428) has the molecular formula C14H16ClF3N4O2S
and a molecular weight of 396.82 g/mol. Its IUPAC name is 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide |
| PubChem CID | 120778428 |
| Molecular Formula | C14H16ClF3N4O2S |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide |
| SMILES | N#Cc1c(Cl)cccc1S(=O)(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C14H16ClF3N4O2S/c15-11-2-1-3-12(10(11)8-19)25(23,24)21-9-13(14(16,17)18)22-6-4-20-5-7-22/h1-3,13,20-21H,4-7,9H2 |
| InChIKey | YMOCPWWFZRQLIP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide?
The IUPAC name of 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide (CID 120778428) is 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide.
What is the SMILES notation for 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide?
The canonical SMILES for 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide is N#Cc1c(Cl)cccc1S(=O)(=O)NCC(N1CCNCC1)C(F)(F)F.
What is the InChIKey of 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide?
The InChIKey is YMOCPWWFZRQLIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF3N4O2S/c15-11-2-1-3-12(10(11)8-19)25(23,24)21-9-13(14(16,17)18)22-6-4-20-5-7-22/h1-3,13,20-21H,4-7,9H2.
What are the key properties of 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide?
3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide has a molecular weight of 396.82 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-cyano-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide is sourced from PubChem (CID 120778428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).