About 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride
1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride (PubChem CID 120778499) has the molecular formula C12H23ClF3N3O3S
and a molecular weight of 381.85 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride |
| PubChem CID | 120778499 |
| Molecular Formula | C12H23ClF3N3O3S |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(CC1CCOC1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H22F3N3O3S.ClH/c13-12(14,15)11(18-4-2-16-3-5-18)7-17-22(19,20)9-10-1-6-21-8-10;/h10-11,16-17H,1-9H2;1H |
| InChIKey | CRQOLZXGUGUBCI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
The IUPAC name of 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride (CID 120778499) is 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride.
What is the SMILES notation for 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
The canonical SMILES for 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride is Cl.O=S(=O)(CC1CCOC1)NCC(N1CCNCC1)C(F)(F)F.
What is the InChIKey of 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
The InChIKey is CRQOLZXGUGUBCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N3O3S.ClH/c13-12(14,15)11(18-4-2-16-3-5-18)7-17-22(19,20)9-10-1-6-21-8-10;/h10-11,16-17H,1-9H2;1H.
What are the key properties of 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride has a molecular weight of 381.85 g/mol, XLogP of 0.20, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride is sourced from PubChem (CID 120778499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).