About N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride
N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride (PubChem CID 120778571) has the molecular formula C11H21ClF3N3O2S
and a molecular weight of 351.82 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride |
| PubChem CID | 120778571 |
| Molecular Formula | C11H21ClF3N3O2S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride |
| SMILES | C=CCCS(=O)(=O)NCC(N1CCNCC1)C(F)(F)F.Cl |
| InChI | InChI=1S/C11H20F3N3O2S.ClH/c1-2-3-8-20(18,19)16-9-10(11(12,13)14)17-6-4-15-5-7-17;/h2,10,15-16H,1,3-9H2;1H |
| InChIKey | XXYAGGKGMHUTIG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride?
The IUPAC name of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride (CID 120778571) is N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride.
What is the SMILES notation for N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride?
The canonical SMILES for N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride is C=CCCS(=O)(=O)NCC(N1CCNCC1)C(F)(F)F.Cl.
What is the InChIKey of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride?
The InChIKey is XXYAGGKGMHUTIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3N3O2S.ClH/c1-2-3-8-20(18,19)16-9-10(11(12,13)14)17-6-4-15-5-7-17;/h2,10,15-16H,1,3-9H2;1H.
What are the key properties of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride?
N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride has a molecular weight of 351.82 g/mol, XLogP of 0.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)but-3-ene-1-sulfonamide;hydrochloride is sourced from PubChem (CID 120778571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).