methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate

C10H10N2O3 — CID 1207796

IUPACmethyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate
SMILESCOC(=O)c1cc2nc(OC)ccc2[nH]1
InChIInChI=1S/C10H10N2O3/c1-14-9-4-3-6-7(12-9)5-8(11-6)10(13)15-2/h3-5,11H,1-2H3
InChIKeySHVFIZNVOPHROP-UHFFFAOYSA-N
MW206.20 g/mol
LogP1.36
Rot. Bonds2

About methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate

methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (PubChem CID 1207796) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate
PubChem CID1207796
Molecular FormulaC10H10N2O3
Molecular Weight206.20 g/mol
Exact Mass206.07
IUPAC Namemethyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate
SMILESCOC(=O)c1cc2nc(OC)ccc2[nH]1
InChIInChI=1S/C10H10N2O3/c1-14-9-4-3-6-7(12-9)5-8(11-6)10(13)15-2/h3-5,11H,1-2H3
InChIKeySHVFIZNVOPHROP-UHFFFAOYSA-N
XLogP1.36
TPSA64.21 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The IUPAC name of methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CID 1207796) is methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is COC(=O)c1cc2nc(OC)ccc2[nH]1.
What is the InChIKey of methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
The InChIKey is SHVFIZNVOPHROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c1-14-9-4-3-6-7(12-9)5-8(11-6)10(13)15-2/h3-5,11H,1-2H3.
What are the key properties of methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate?
methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate has a molecular weight of 206.20 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is sourced from PubChem (CID 1207796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).