C14H21ClN2O2S — CID 120779997
1-(2-chloro-4-methylphenyl)sulfonyl-3,3-dimethylpiperidin-4-amine (PubChem CID 120779997) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)sulfonyl-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(2-chloro-4-methylphenyl)sulfonyl-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120779997 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)sulfonyl-3,3-dimethylpiperidin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(N)C(C)(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O2S/c1-10-4-5-12(11(15)8-10)20(18,19)17-7-6-13(16)14(2,3)9-17/h4-5,8,13H,6-7,9,16H2,1-3H3 |
| InChIKey | GLGPYTUBUKYUJA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |