C17H29ClN2O3 — CID 120780613
[1-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120780613) has the molecular formula C17H29ClN2O3 and a molecular weight of 344.88 g/mol. Its IUPAC name is [1-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120780613 |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [1-[[3-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | COCCOc1ccc(CN2CCC(C)(CN)C2)cc1OC.Cl |
| InChI | InChI=1S/C17H28N2O3.ClH/c1-17(12-18)6-7-19(13-17)11-14-4-5-15(16(10-14)21-3)22-9-8-20-2;/h4-5,10H,6-9,11-13,18H2,1-3H3;1H |
| InChIKey | LMATVTLSCNYNFA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|