About [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine
[1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 120781080) has the molecular formula C12H17Br2N3
and a molecular weight of 363.10 g/mol. Its IUPAC name is [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 120781080 |
| Molecular Formula | C12H17Br2N3 |
| Molecular Weight | 363.10 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(Cc2ncc(Br)cc2Br)C1 |
| InChI | InChI=1S/C12H17Br2N3/c1-12(7-15)2-3-17(8-12)6-11-10(14)4-9(13)5-16-11/h4-5H,2-3,6-8,15H2,1H3 |
| InChIKey | IPRXZXPQFVMPFE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine (CID 120781080) is [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine is CC1(CN)CCN(Cc2ncc(Br)cc2Br)C1.
What is the InChIKey of [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine?
The InChIKey is IPRXZXPQFVMPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Br2N3/c1-12(7-15)2-3-17(8-12)6-11-10(14)4-9(13)5-16-11/h4-5H,2-3,6-8,15H2,1H3.
What are the key properties of [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine?
[1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine has a molecular weight of 363.10 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,5-dibromo-2-pyridinyl)methyl]-3-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 120781080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).