C20H24N2O2 — CID 120784380
(2S,5R)-5-(aminomethyl)-N-(1,2-diphenylethyl)oxolane-2-carboxamide (PubChem CID 120784380) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(1,2-diphenylethyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(1,2-diphenylethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120784380 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(1,2-diphenylethyl)oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)NC(Cc2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C20H24N2O2/c21-14-17-11-12-19(24-17)20(23)22-18(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-10,17-19H,11-14,21H2,(H,22,23)/t17-,18?,19+/m1/s1 |
| InChIKey | VFXBEDPMZOOCAX-KGNCLDLBSA-N |
| XLogP | 2.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |