C16H22N2O2S2 — CID 120784582
2-amino-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-(oxan-4-yl)acetamide (PubChem CID 120784582) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-amino-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120784582 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-amino-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)Nc1cccc(C2SCCS2)c1)C1CCOCC1 |
| InChI | InChI=1S/C16H22N2O2S2/c17-14(11-4-6-20-7-5-11)15(19)18-13-3-1-2-12(10-13)16-21-8-9-22-16/h1-3,10-11,14,16H,4-9,17H2,(H,18,19) |
| InChIKey | XOTDOGZLNWVVDF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |