About methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate
methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate (PubChem CID 120785620) has the molecular formula C13H22N2O4
and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate |
| PubChem CID | 120785620 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)[C@@H]2CC[C@H](CN)O2)CCCC1 |
| InChI | InChI=1S/C13H22N2O4/c1-18-12(17)13(6-2-3-7-13)15-11(16)10-5-4-9(8-14)19-10/h9-10H,2-8,14H2,1H3,(H,15,16)/t9-,10+/m1/s1 |
| InChIKey | JUGKKFDBYBRHKI-ZJUUUORDSA-N |
| XLogP | 0.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate?
The IUPAC name of methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate (CID 120785620) is methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate?
The canonical SMILES for methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate is COC(=O)C1(NC(=O)[C@@H]2CC[C@H](CN)O2)CCCC1.
What is the InChIKey of methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate?
The InChIKey is JUGKKFDBYBRHKI-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H22N2O4/c1-18-12(17)13(6-2-3-7-13)15-11(16)10-5-4-9(8-14)19-10/h9-10H,2-8,14H2,1H3,(H,15,16)/t9-,10+/m1/s1.
What are the key properties of methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate?
methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate has a molecular weight of 270.33 g/mol, XLogP of 0.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]cyclopentane-1-carboxylate is sourced from PubChem (CID 120785620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).