C19H28ClN3O4 — CID 120786223
2-amino-1-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride (PubChem CID 120786223) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is 2-amino-1-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120786223 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-amino-1-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)C(N)C3CCOCC3)CC2)cc1.Cl |
| InChI | InChI=1S/C19H27N3O4.ClH/c1-25-16-4-2-15(3-5-16)18(23)21-8-10-22(11-9-21)19(24)17(20)14-6-12-26-13-7-14;/h2-5,14,17H,6-13,20H2,1H3;1H |
| InChIKey | INNIQVPMDHOKSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |