C22H29ClN2O4 — CID 120787393
2-amino-2-(oxan-4-yl)-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide;hydrochloride (PubChem CID 120787393) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120787393 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[3-(2-phenoxyethoxymethyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)Nc1cccc(COCCOc2ccccc2)c1)C1CCOCC1 |
| InChI | InChI=1S/C22H28N2O4.ClH/c23-21(18-9-11-26-12-10-18)22(25)24-19-6-4-5-17(15-19)16-27-13-14-28-20-7-2-1-3-8-20;/h1-8,15,18,21H,9-14,16,23H2,(H,24,25);1H |
| InChIKey | GXVVKNVIHGIYIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|