C17H29N3O3 — CID 120787494
1-[2-amino-2-(oxan-4-yl)acetyl]-N-(cyclopropylmethyl)piperidine-3-carboxamide (PubChem CID 120787494) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[2-amino-2-(oxan-4-yl)acetyl]-N-(cyclopropylmethyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-amino-2-(oxan-4-yl)acetyl]-N-(cyclopropylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120787494 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 1-[2-amino-2-(oxan-4-yl)acetyl]-N-(cyclopropylmethyl)piperidine-3-carboxamide |
| SMILES | NC(C(=O)N1CCCC(C(=O)NCC2CC2)C1)C1CCOCC1 |
| InChI | InChI=1S/C17H29N3O3/c18-15(13-5-8-23-9-6-13)17(22)20-7-1-2-14(11-20)16(21)19-10-12-3-4-12/h12-15H,1-11,18H2,(H,19,21) |
| InChIKey | ABOWOMPCTASMRJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |