About 3-nitrobenzonitrile
3-nitrobenzonitrile (PubChem CID 12079) has the molecular formula C7H4N2O2
and a molecular weight of 148.12 g/mol. Its IUPAC name is 3-nitrobenzonitrile.
Molecular Properties
| Compound Name | 3-nitrobenzonitrile |
| PubChem CID | 12079 |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 3-nitrobenzonitrile |
| SMILES | N#Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4N2O2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H |
| InChIKey | RUSAWEHOGCWOPG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzonitrile?
The IUPAC name of 3-nitrobenzonitrile (CID 12079) is 3-nitrobenzonitrile.
What is the SMILES notation for 3-nitrobenzonitrile?
The canonical SMILES for 3-nitrobenzonitrile is N#Cc1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitrobenzonitrile?
The InChIKey is RUSAWEHOGCWOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H.
What are the key properties of 3-nitrobenzonitrile?
3-nitrobenzonitrile has a molecular weight of 148.12 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzonitrile is sourced from PubChem (CID 12079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).