C19H30N2O2 — CID 120790392
2-amino-N-(4-methyl-4-phenylpentan-2-yl)-2-(oxan-4-yl)acetamide (PubChem CID 120790392) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-amino-N-(4-methyl-4-phenylpentan-2-yl)-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-(4-methyl-4-phenylpentan-2-yl)-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120790392 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2-amino-N-(4-methyl-4-phenylpentan-2-yl)-2-(oxan-4-yl)acetamide |
| SMILES | CC(CC(C)(C)c1ccccc1)NC(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C19H30N2O2/c1-14(13-19(2,3)16-7-5-4-6-8-16)21-18(22)17(20)15-9-11-23-12-10-15/h4-8,14-15,17H,9-13,20H2,1-3H3,(H,21,22) |
| InChIKey | XHQSWAWNEPDQCB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |