C16H30ClN3O3 — CID 120791439
(2S,5R)-5-(aminomethyl)-N-[2-[(2-cyclohexylacetyl)amino]ethyl]oxolane-2-carboxamide;hydrochloride (PubChem CID 120791439) has the molecular formula C16H30ClN3O3 and a molecular weight of 347.89 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-[(2-cyclohexylacetyl)amino]ethyl]oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-[(2-cyclohexylacetyl)amino]ethyl]oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120791439 |
| Molecular Formula | C16H30ClN3O3 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-[(2-cyclohexylacetyl)amino]ethyl]oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)NCCNC(=O)CC2CCCCC2)O1 |
| InChI | InChI=1S/C16H29N3O3.ClH/c17-11-13-6-7-14(22-13)16(21)19-9-8-18-15(20)10-12-4-2-1-3-5-12;/h12-14H,1-11,17H2,(H,18,20)(H,19,21);1H/t13-,14+;/m1./s1 |
| InChIKey | UVYDMZFBRSLINB-DFQHDRSWSA-N |
| XLogP | 1.12 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|