C19H24ClN3O3 — CID 120791541
2-amino-N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120791541) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-amino-N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120791541 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-amino-N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)NCC(=O)Nc1cccc2ccccc12)C1CCOCC1 |
| InChI | InChI=1S/C19H23N3O3.ClH/c20-18(14-8-10-25-11-9-14)19(24)21-12-17(23)22-16-7-3-5-13-4-1-2-6-15(13)16;/h1-7,14,18H,8-12,20H2,(H,21,24)(H,22,23);1H |
| InChIKey | RKZAFDCITFYWES-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |