C14H19BrN2O3 — CID 120791756
2-amino-N-(3-bromo-4-methoxyphenyl)-2-(oxan-4-yl)acetamide (PubChem CID 120791756) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-amino-N-(3-bromo-4-methoxyphenyl)-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-(3-bromo-4-methoxyphenyl)-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120791756 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-amino-N-(3-bromo-4-methoxyphenyl)-2-(oxan-4-yl)acetamide |
| SMILES | COc1ccc(NC(=O)C(N)C2CCOCC2)cc1Br |
| InChI | InChI=1S/C14H19BrN2O3/c1-19-12-3-2-10(8-11(12)15)17-14(18)13(16)9-4-6-20-7-5-9/h2-3,8-9,13H,4-7,16H2,1H3,(H,17,18) |
| InChIKey | MWVQPSZCNPURFT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |