C20H24N2O4S — CID 120794006
(2S,5R)-5-(aminomethyl)-N-[3-(benzylsulfonylmethyl)phenyl]oxolane-2-carboxamide (PubChem CID 120794006) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[3-(benzylsulfonylmethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[3-(benzylsulfonylmethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120794006 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[3-(benzylsulfonylmethyl)phenyl]oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)Nc2cccc(CS(=O)(=O)Cc3ccccc3)c2)O1 |
| InChI | InChI=1S/C20H24N2O4S/c21-12-18-9-10-19(26-18)20(23)22-17-8-4-7-16(11-17)14-27(24,25)13-15-5-2-1-3-6-15/h1-8,11,18-19H,9-10,12-14,21H2,(H,22,23)/t18-,19+/m1/s1 |
| InChIKey | IOXABSXAQDNYDM-MOPGFXCFSA-N |
| XLogP | 2.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |