C17H23ClN4O5 — CID 120794595
[(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120794595) has the molecular formula C17H23ClN4O5 and a molecular weight of 398.85 g/mol. Its IUPAC name is [(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | [(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120794595 |
| Molecular Formula | C17H23ClN4O5 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)O1 |
| InChI | InChI=1S/C17H22N4O5.ClH/c18-11-14-5-6-15(26-14)17(23)20-9-7-19(8-10-20)16(22)12-1-3-13(4-2-12)21(24)25;/h1-4,14-15H,5-11,18H2;1H/t14-,15+;/m1./s1 |
| InChIKey | BILCBSSNOYIPGI-LIOBNPLQSA-N |
| XLogP | 0.81 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|